C24H19ClO5 — CID 5090250
[2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 5090250) has the molecular formula C24H19ClO5 and a molecular weight of 422.86 g/mol. Its IUPAC name is [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 5090250 |
| Molecular Formula | C24H19ClO5 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccc2C=CC(=O)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C24H19ClO5/c1-28-22-14-10-18(15-23(22)29-2)24(27)30-21-6-4-3-5-17(21)9-13-20(26)16-7-11-19(25)12-8-16/h3-15H,1-2H3 |
| InChIKey | RCWMENRQMWBCQK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|