About [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate
[2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate (PubChem CID 3545267) has the molecular formula C22H14ClNO5
and a molecular weight of 407.81 g/mol. Its IUPAC name is [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate.
Molecular Properties
| Compound Name | [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate |
| PubChem CID | 3545267 |
| Molecular Formula | C22H14ClNO5 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate |
| SMILES | O=C(C=Cc1ccccc1OC(=O)c1cccc([N+](=O)[O-])c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14ClNO5/c23-18-11-8-15(9-12-18)20(25)13-10-16-4-1-2-7-21(16)29-22(26)17-5-3-6-19(14-17)24(27)28/h1-14H |
| InChIKey | YHVGCABHLKEDDH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate?
The IUPAC name of [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate (CID 3545267) is [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate.
What is the SMILES notation for [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate?
The canonical SMILES for [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate is O=C(C=Cc1ccccc1OC(=O)c1cccc([N+](=O)[O-])c1)c1ccc(Cl)cc1.
What is the InChIKey of [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate?
The InChIKey is YHVGCABHLKEDDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14ClNO5/c23-18-11-8-15(9-12-18)20(25)13-10-16-4-1-2-7-21(16)29-22(26)17-5-3-6-19(14-17)24(27)28/h1-14H.
What are the key properties of [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate?
[2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate has a molecular weight of 407.81 g/mol, XLogP of 5.36, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[3-(4-chlorophenyl)-3-oxoprop-1-enyl]phenyl] 3-nitrobenzoate is sourced from PubChem (CID 3545267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).