About (2-nitrophenyl) 3-nitrobenzoate
(2-nitrophenyl) 3-nitrobenzoate (PubChem CID 3339758) has the molecular formula C13H8N2O6
and a molecular weight of 288.22 g/mol. Its IUPAC name is (2-nitrophenyl) 3-nitrobenzoate.
Molecular Properties
| Compound Name | (2-nitrophenyl) 3-nitrobenzoate |
| PubChem CID | 3339758 |
| Molecular Formula | C13H8N2O6 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (2-nitrophenyl) 3-nitrobenzoate |
| SMILES | O=C(Oc1ccccc1[N+](=O)[O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8N2O6/c16-13(9-4-3-5-10(8-9)14(17)18)21-12-7-2-1-6-11(12)15(19)20/h1-8H |
| InChIKey | DKIURRBCWPKVDQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl) 3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl) 3-nitrobenzoate?
The IUPAC name of (2-nitrophenyl) 3-nitrobenzoate (CID 3339758) is (2-nitrophenyl) 3-nitrobenzoate.
What is the SMILES notation for (2-nitrophenyl) 3-nitrobenzoate?
The canonical SMILES for (2-nitrophenyl) 3-nitrobenzoate is O=C(Oc1ccccc1[N+](=O)[O-])c1cccc([N+](=O)[O-])c1.
What is the InChIKey of (2-nitrophenyl) 3-nitrobenzoate?
The InChIKey is DKIURRBCWPKVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O6/c16-13(9-4-3-5-10(8-9)14(17)18)21-12-7-2-1-6-11(12)15(19)20/h1-8H.
What are the key properties of (2-nitrophenyl) 3-nitrobenzoate?
(2-nitrophenyl) 3-nitrobenzoate has a molecular weight of 288.22 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl) 3-nitrobenzoate is sourced from PubChem (CID 3339758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).