C16H15NO7 — CID 905326
(2-nitrophenyl) 3,4,5-trimethoxybenzoate (PubChem CID 905326) has the molecular formula C16H15NO7 and a molecular weight of 333.30 g/mol. Its IUPAC name is (2-nitrophenyl) 3,4,5-trimethoxybenzoate.
| Compound Name | (2-nitrophenyl) 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 905326 |
| Molecular Formula | C16H15NO7 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (2-nitrophenyl) 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccccc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C16H15NO7/c1-21-13-8-10(9-14(22-2)15(13)23-3)16(18)24-12-7-5-4-6-11(12)17(19)20/h4-9H,1-3H3 |
| InChIKey | JLZAVDKILYYAHK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|