C16H12ClFN2O7 — CID 55487110
(5-fluoro-2-nitrophenyl) 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoate (PubChem CID 55487110) has the molecular formula C16H12ClFN2O7 and a molecular weight of 398.73 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoate.
| Compound Name | (5-fluoro-2-nitrophenyl) 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoate |
|---|---|
| PubChem CID | 55487110 |
| Molecular Formula | C16H12ClFN2O7 |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2cc(F)ccc2[N+](=O)[O-])cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C16H12ClFN2O7/c1-25-13-5-8(4-10(17)15(13)26-7-14(19)21)16(22)27-12-6-9(18)2-3-11(12)20(23)24/h2-6H,7H2,1H3,(H2,19,21) |
| InChIKey | SVVHSJRSDOBBBK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|