C21H20ClNO8 — CID 24651976
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoate (PubChem CID 24651976) has the molecular formula C21H20ClNO8 and a molecular weight of 449.84 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoate |
|---|---|
| PubChem CID | 24651976 |
| Molecular Formula | C21H20ClNO8 |
| Molecular Weight | 449.84 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)c2cc(Cl)c(OCC(N)=O)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C21H20ClNO8/c1-27-16-8-12(5-7-19(25)29-3)4-6-15(16)31-21(26)13-9-14(22)20(17(10-13)28-2)30-11-18(23)24/h4-10H,11H2,1-3H3,(H2,23,24)/b7-5+ |
| InChIKey | FEMPLHXOERDHAI-FNORWQNLSA-N |
| XLogP | 2.63 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|