C20H19ClO7 — CID 36832071
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-chloro-4,5-dimethoxybenzoate (PubChem CID 36832071) has the molecular formula C20H19ClO7 and a molecular weight of 406.82 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 36832071 |
| Molecular Formula | C20H19ClO7 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-chloro-4,5-dimethoxybenzoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)c2cc(Cl)c(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C20H19ClO7/c1-24-16-9-12(6-8-18(22)26-3)5-7-15(16)28-20(23)13-10-14(21)19(27-4)17(11-13)25-2/h5-11H,1-4H3/b8-6+ |
| InChIKey | BFTWCBOPDFZZPN-SOFGYWHQSA-N |
| XLogP | 3.77 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|