C14H16O7 — CID 67782584
[2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenyl] 2,3-dihydroxypropanoate (PubChem CID 67782584) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is [2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenyl] 2,3-dihydroxypropanoate.
| Compound Name | [2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenyl] 2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 67782584 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | [2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenyl] 2,3-dihydroxypropanoate |
| SMILES | COC(=O)C=Cc1ccc(OC(=O)C(O)CO)c(OC)c1 |
| InChI | InChI=1S/C14H16O7/c1-19-12-7-9(4-6-13(17)20-2)3-5-11(12)21-14(18)10(16)8-15/h3-7,10,15-16H,8H2,1-2H3 |
| InChIKey | CHHJAHCENCWCOL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|