C29H32O10 — CID 148676132
[4-[(1E,6E)-7-[4-[(3R)-3-hydroxybutanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (3R)-3-hydroxybutanoate (PubChem CID 148676132) has the molecular formula C29H32O10 and a molecular weight of 540.57 g/mol. Its IUPAC name is [4-[(1E,6E)-7-[4-[(3R)-3-hydroxybutanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (3R)-3-hydroxybutanoate.
| Compound Name | [4-[(1E,6E)-7-[4-[(3R)-3-hydroxybutanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (3R)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 148676132 |
| Molecular Formula | C29H32O10 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | [4-[(1E,6E)-7-[4-[(3R)-3-hydroxybutanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (3R)-3-hydroxybutanoate |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)C[C@@H](C)O)c(OC)c2)ccc1OC(=O)C[C@@H](C)O |
| InChI | InChI=1S/C29H32O10/c1-18(30)13-28(34)38-24-11-7-20(15-26(24)36-3)5-9-22(32)17-23(33)10-6-21-8-12-25(27(16-21)37-4)39-29(35)14-19(2)31/h5-12,15-16,18-19,30-31H,13-14,17H2,1-4H3/b9-5+,10-6+/t18-,19-/m1/s1 |
| InChIKey | NQRMNZRWNOXFIT-JMNLFSHGSA-N |
| XLogP | 3.31 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|