C45H42N2O14 — CID 134452434
3-O-[4-[(1E,6E)-7-[4-[3-(4-acetamidophenoxy)-2-methyl-3-oxopropanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 1-O-(4-acetamidophenyl) 2-methylpropanedioate (PubChem CID 134452434) has the molecular formula C45H42N2O14 and a molecular weight of 834.83 g/mol. Its IUPAC name is 3-O-[4-[(1E,6E)-7-[4-[3-(4-acetamidophenoxy)-2-methyl-3-oxopropanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 1-O-(4-acetamidophenyl) 2-methylpropanedioate.
| Compound Name | 3-O-[4-[(1E,6E)-7-[4-[3-(4-acetamidophenoxy)-2-methyl-3-oxopropanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 1-O-(4-acetamidophenyl) 2-methylpropanedioate |
|---|---|
| PubChem CID | 134452434 |
| Molecular Formula | C45H42N2O14 |
| Molecular Weight | 834.83 g/mol |
| Exact Mass | 834.26 |
| IUPAC Name | 3-O-[4-[(1E,6E)-7-[4-[3-(4-acetamidophenoxy)-2-methyl-3-oxopropanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 1-O-(4-acetamidophenyl) 2-methylpropanedioate |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)C(C)C(=O)Oc3ccc(NC(C)=O)cc3)c(OC)c2)ccc1OC(=O)C(C)C(=O)Oc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C45H42N2O14/c1-26(42(52)58-36-17-11-32(12-18-36)46-28(3)48)44(54)60-38-21-9-30(23-40(38)56-5)7-15-34(50)25-35(51)16-8-31-10-22-39(41(24-31)57-6)61-45(55)27(2)43(53)59-37-19-13-33(14-20-37)47-29(4)49/h7-24,26-27H,25H2,1-6H3,(H,46,48)(H,47,49)/b15-7+,16-8+ |
| InChIKey | JZXAACVFTIBMER-BGPOSVGRSA-N |
| XLogP | 6.17 |
| TPSA | 216.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.83 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|