C31H36N4O10 — CID 134450005
[4-[(1E,6E)-7-[4-[(2S)-2,5-diamino-5-oxopentanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (2S)-2,5-diamino-5-oxopentanoate (PubChem CID 134450005) has the molecular formula C31H36N4O10 and a molecular weight of 624.65 g/mol. Its IUPAC name is [4-[(1E,6E)-7-[4-[(2S)-2,5-diamino-5-oxopentanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (2S)-2,5-diamino-5-oxopentanoate.
| Compound Name | [4-[(1E,6E)-7-[4-[(2S)-2,5-diamino-5-oxopentanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (2S)-2,5-diamino-5-oxopentanoate |
|---|---|
| PubChem CID | 134450005 |
| Molecular Formula | C31H36N4O10 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | [4-[(1E,6E)-7-[4-[(2S)-2,5-diamino-5-oxopentanoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (2S)-2,5-diamino-5-oxopentanoate |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)[C@@H](N)CCC(N)=O)c(OC)c2)ccc1OC(=O)[C@@H](N)CCC(N)=O |
| InChI | InChI=1S/C31H36N4O10/c1-42-26-15-18(5-11-24(26)44-30(40)22(32)9-13-28(34)38)3-7-20(36)17-21(37)8-4-19-6-12-25(27(16-19)43-2)45-31(41)23(33)10-14-29(35)39/h3-8,11-12,15-16,22-23H,9-10,13-14,17,32-33H2,1-2H3,(H2,34,38)(H2,35,39)/b7-3+,8-4+/t22-,23-/m0/s1 |
| InChIKey | AYMRWBKMNZYJHS-LHVYAWJFSA-N |
| XLogP | 0.96 |
| TPSA | 243.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|