C25H27NO7 — CID 123229969
[4-[7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] N,N-dimethylcarbamate (PubChem CID 123229969) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is [4-[7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] N,N-dimethylcarbamate.
| Compound Name | [4-[7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 123229969 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [4-[7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] N,N-dimethylcarbamate |
| SMILES | COc1ccc(C=CC(=O)CC(=O)C=Cc2ccc(OC(=O)N(C)C)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H27NO7/c1-26(2)25(29)33-22-13-9-18(15-24(22)32-5)7-11-20(28)16-19(27)10-6-17-8-12-21(30-3)23(14-17)31-4/h6-15H,16H2,1-5H3 |
| InChIKey | YMURKNKHLSZMMM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|