C28H31NO7 — CID 78089913
[4-[7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] piperidine-1-carboxylate (PubChem CID 78089913) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is [4-[7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] piperidine-1-carboxylate.
| Compound Name | [4-[7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 78089913 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | [4-[7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] piperidine-1-carboxylate |
| SMILES | COc1ccc(C=CC(=O)CC(=O)C=Cc2ccc(OC(=O)N3CCCCC3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H31NO7/c1-33-24-13-9-20(17-26(24)34-2)7-11-22(30)19-23(31)12-8-21-10-14-25(27(18-21)35-3)36-28(32)29-15-5-4-6-16-29/h7-14,17-18H,4-6,15-16,19H2,1-3H3 |
| InChIKey | OFBYGAPYRUWFKK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|