C31H36N4O8 — CID 78090274
[2-methoxy-4-[7-[3-methoxy-4-(piperazine-1-carbonyloxy)phenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] piperazine-1-carboxylate (PubChem CID 78090274) has the molecular formula C31H36N4O8 and a molecular weight of 592.65 g/mol. Its IUPAC name is [2-methoxy-4-[7-[3-methoxy-4-(piperazine-1-carbonyloxy)phenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] piperazine-1-carboxylate.
| Compound Name | [2-methoxy-4-[7-[3-methoxy-4-(piperazine-1-carbonyloxy)phenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 78090274 |
| Molecular Formula | C31H36N4O8 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | [2-methoxy-4-[7-[3-methoxy-4-(piperazine-1-carbonyloxy)phenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] piperazine-1-carboxylate |
| SMILES | COc1cc(C=CC(=O)CC(=O)C=Cc2ccc(OC(=O)N3CCNCC3)c(OC)c2)ccc1OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C31H36N4O8/c1-40-28-19-22(5-9-26(28)42-30(38)34-15-11-32-12-16-34)3-7-24(36)21-25(37)8-4-23-6-10-27(29(20-23)41-2)43-31(39)35-17-13-33-14-18-35/h3-10,19-20,32-33H,11-18,21H2,1-2H3 |
| InChIKey | AYZPNKPSLIGQHH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|