C19H28N2O5 — CID 144528678
[2-methoxy-4-(2-methoxycarbonyl-3-methylbutyl)phenyl] piperazine-1-carboxylate (PubChem CID 144528678) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is [2-methoxy-4-(2-methoxycarbonyl-3-methylbutyl)phenyl] piperazine-1-carboxylate.
| Compound Name | [2-methoxy-4-(2-methoxycarbonyl-3-methylbutyl)phenyl] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 144528678 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [2-methoxy-4-(2-methoxycarbonyl-3-methylbutyl)phenyl] piperazine-1-carboxylate |
| SMILES | COC(=O)C(Cc1ccc(OC(=O)N2CCNCC2)c(OC)c1)C(C)C |
| InChI | InChI=1S/C19H28N2O5/c1-13(2)15(18(22)25-4)11-14-5-6-16(17(12-14)24-3)26-19(23)21-9-7-20-8-10-21/h5-6,12-13,15,20H,7-11H2,1-4H3 |
| InChIKey | DGALZFNEECRPNA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |