C13H18O4 — CID 70875448
methyl (2R)-2-[(3,4-dihydroxyphenyl)methyl]-3-methylbutanoate (PubChem CID 70875448) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is methyl (2R)-2-[(3,4-dihydroxyphenyl)methyl]-3-methylbutanoate.
| Compound Name | methyl (2R)-2-[(3,4-dihydroxyphenyl)methyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 70875448 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | methyl (2R)-2-[(3,4-dihydroxyphenyl)methyl]-3-methylbutanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)C(C)C |
| InChI | InChI=1S/C13H18O4/c1-8(2)10(13(16)17-3)6-9-4-5-11(14)12(15)7-9/h4-5,7-8,10,14-15H,6H2,1-3H3/t10-/m1/s1 |
| InChIKey | JLGZMOMGHJYOKI-SNVBAGLBSA-N |
| XLogP | 2.09 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|