C19H22N2O4 — CID 98548920
(Z,2R)-5-(3,4-dimethoxyphenyl)-3-oxo-2-(piperidine-1-carbonyl)pent-4-enenitrile (PubChem CID 98548920) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (Z,2R)-5-(3,4-dimethoxyphenyl)-3-oxo-2-(piperidine-1-carbonyl)pent-4-enenitrile.
| Compound Name | (Z,2R)-5-(3,4-dimethoxyphenyl)-3-oxo-2-(piperidine-1-carbonyl)pent-4-enenitrile |
|---|---|
| PubChem CID | 98548920 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (Z,2R)-5-(3,4-dimethoxyphenyl)-3-oxo-2-(piperidine-1-carbonyl)pent-4-enenitrile |
| SMILES | COc1ccc(/C=C\C(=O)[C@@H](C#N)C(=O)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C19H22N2O4/c1-24-17-9-7-14(12-18(17)25-2)6-8-16(22)15(13-20)19(23)21-10-4-3-5-11-21/h6-9,12,15H,3-5,10-11H2,1-2H3/b8-6-/t15-/m1/s1 |
| InChIKey | OGAYGSLLFMFKSX-DDJMYBDESA-N |
| XLogP | 2.44 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|