C23H34N2O4 — CID 86948716
(E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[(2S)-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl]prop-2-enamide (PubChem CID 86948716) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[(2S)-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[(2S)-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 86948716 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[(2S)-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N[C@H](C(=O)N2CCCC2)C(C)C)ccc1OCC(C)C |
| InChI | InChI=1S/C23H34N2O4/c1-16(2)15-29-19-10-8-18(14-20(19)28-5)9-11-21(26)24-22(17(3)4)23(27)25-12-6-7-13-25/h8-11,14,16-17,22H,6-7,12-13,15H2,1-5H3,(H,24,26)/b11-9+/t22-/m0/s1 |
| InChIKey | KGPIUEVOMLSORJ-CRWWQRIJSA-N |
| XLogP | 3.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|