C16H12FNO6 — CID 91727008
1-O-ethyl 3-O-(5-fluoro-2-nitrophenyl) benzene-1,3-dicarboxylate (PubChem CID 91727008) has the molecular formula C16H12FNO6 and a molecular weight of 333.27 g/mol. Its IUPAC name is 1-O-ethyl 3-O-(5-fluoro-2-nitrophenyl) benzene-1,3-dicarboxylate.
| Compound Name | 1-O-ethyl 3-O-(5-fluoro-2-nitrophenyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 91727008 |
| Molecular Formula | C16H12FNO6 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-O-ethyl 3-O-(5-fluoro-2-nitrophenyl) benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cccc(C(=O)Oc2cc(F)ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12FNO6/c1-2-23-15(19)10-4-3-5-11(8-10)16(20)24-14-9-12(17)6-7-13(14)18(21)22/h3-9H,2H2,1H3 |
| InChIKey | BSNVQFSBVYUNGP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|