About (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate
(5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate (PubChem CID 9455312) has the molecular formula C17H11FN2O4
and a molecular weight of 326.28 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate.
Molecular Properties
| Compound Name | (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate |
| PubChem CID | 9455312 |
| Molecular Formula | C17H11FN2O4 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate |
| SMILES | O=C(Oc1cc(F)ccc1[N+](=O)[O-])c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C17H11FN2O4/c18-13-5-8-15(20(22)23)16(11-13)24-17(21)12-3-6-14(7-4-12)19-9-1-2-10-19/h1-11H |
| InChIKey | YXKGTUFSDSXUSI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate?
The IUPAC name of (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate (CID 9455312) is (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate.
What is the SMILES notation for (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate?
The canonical SMILES for (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate is O=C(Oc1cc(F)ccc1[N+](=O)[O-])c1ccc(-n2cccc2)cc1.
What is the InChIKey of (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate?
The InChIKey is YXKGTUFSDSXUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FN2O4/c18-13-5-8-15(20(22)23)16(11-13)24-17(21)12-3-6-14(7-4-12)19-9-1-2-10-19/h1-11H.
What are the key properties of (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate?
(5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate has a molecular weight of 326.28 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2-nitrophenyl) 4-pyrrol-1-ylbenzoate is sourced from PubChem (CID 9455312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).