About (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate
(5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate (PubChem CID 55577155) has the molecular formula C18H17FN2O6S
and a molecular weight of 408.41 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate |
| PubChem CID | 55577155 |
| Molecular Formula | C18H17FN2O6S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate |
| SMILES | O=C(Oc1cc(F)ccc1[N+](=O)[O-])c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C18H17FN2O6S/c19-13-8-9-16(21(23)24)17(11-13)27-18(22)12-4-3-7-15(10-12)28(25,26)20-14-5-1-2-6-14/h3-4,7-11,14,20H,1-2,5-6H2 |
| InChIKey | HVLIJAIOVGVAGD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate?
The IUPAC name of (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate (CID 55577155) is (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate.
What is the SMILES notation for (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate?
The canonical SMILES for (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate is O=C(Oc1cc(F)ccc1[N+](=O)[O-])c1cccc(S(=O)(=O)NC2CCCC2)c1.
What is the InChIKey of (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate?
The InChIKey is HVLIJAIOVGVAGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN2O6S/c19-13-8-9-16(21(23)24)17(11-13)27-18(22)12-4-3-7-15(10-12)28(25,26)20-14-5-1-2-6-14/h3-4,7-11,14,20H,1-2,5-6H2.
What are the key properties of (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate?
(5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate has a molecular weight of 408.41 g/mol, XLogP of 3.17, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2-nitrophenyl) 3-(cyclopentylsulfamoyl)benzoate is sourced from PubChem (CID 55577155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).