C17H19ClFN2O3+ — CID 7632298
[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-[(4-fluorophenyl)methyl]azanium (PubChem CID 7632298) has the molecular formula C17H19ClFN2O3+ and a molecular weight of 353.80 g/mol. Its IUPAC name is [4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-[(4-fluorophenyl)methyl]azanium.
| Compound Name | [4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 7632298 |
| Molecular Formula | C17H19ClFN2O3+ |
| Molecular Weight | 353.80 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-[(4-fluorophenyl)methyl]azanium |
| SMILES | COc1cc(C[NH2+]Cc2ccc(F)cc2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C17H18ClFN2O3/c1-23-15-7-12(6-14(18)17(15)24-10-16(20)22)9-21-8-11-2-4-13(19)5-3-11/h2-7,21H,8-10H2,1H3,(H2,20,22)/p+1 |
| InChIKey | MDPMIAFIEBQMEX-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.80 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |