C18H20ClFN2O3 — CID 35607506
2-[2-chloro-4-[[2-(3-fluorophenyl)ethylamino]methyl]-6-methoxyphenoxy]acetamide (PubChem CID 35607506) has the molecular formula C18H20ClFN2O3 and a molecular weight of 366.82 g/mol. Its IUPAC name is 2-[2-chloro-4-[[2-(3-fluorophenyl)ethylamino]methyl]-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[2-chloro-4-[[2-(3-fluorophenyl)ethylamino]methyl]-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 35607506 |
| Molecular Formula | C18H20ClFN2O3 |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-[2-chloro-4-[[2-(3-fluorophenyl)ethylamino]methyl]-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(CNCCc2cccc(F)c2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C18H20ClFN2O3/c1-24-16-9-13(8-15(19)18(16)25-11-17(21)23)10-22-6-5-12-3-2-4-14(20)7-12/h2-4,7-9,22H,5-6,10-11H2,1H3,(H2,21,23) |
| InChIKey | FICKVNQIPSDDTQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|