C16H19Cl2N3O3 — CID 6462700
2-[2-chloro-6-methoxy-4-[(pyridin-3-ylmethylamino)methyl]phenoxy]acetamide;hydrochloride (PubChem CID 6462700) has the molecular formula C16H19Cl2N3O3 and a molecular weight of 372.25 g/mol. Its IUPAC name is 2-[2-chloro-6-methoxy-4-[(pyridin-3-ylmethylamino)methyl]phenoxy]acetamide;hydrochloride.
| Compound Name | 2-[2-chloro-6-methoxy-4-[(pyridin-3-ylmethylamino)methyl]phenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 6462700 |
| Molecular Formula | C16H19Cl2N3O3 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-[2-chloro-6-methoxy-4-[(pyridin-3-ylmethylamino)methyl]phenoxy]acetamide;hydrochloride |
| SMILES | COc1cc(CNCc2cccnc2)cc(Cl)c1OCC(N)=O.Cl |
| InChI | InChI=1S/C16H18ClN3O3.ClH/c1-22-14-6-12(5-13(17)16(14)23-10-15(18)21)9-20-8-11-3-2-4-19-7-11;/h2-7,20H,8-10H2,1H3,(H2,18,21);1H |
| InChIKey | RXEWJIQBVHXFBL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |