C20H25ClN2O5 — CID 4716345
2-[2-chloro-4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxyphenoxy]acetamide (PubChem CID 4716345) has the molecular formula C20H25ClN2O5 and a molecular weight of 408.88 g/mol. Its IUPAC name is 2-[2-chloro-4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[2-chloro-4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 4716345 |
| Molecular Formula | C20H25ClN2O5 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-[2-chloro-4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxyphenoxy]acetamide |
| SMILES | COc1ccc(CCNCc2cc(Cl)c(OCC(N)=O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H25ClN2O5/c1-25-16-5-4-13(9-17(16)26-2)6-7-23-11-14-8-15(21)20(18(10-14)27-3)28-12-19(22)24/h4-5,8-10,23H,6-7,11-12H2,1-3H3,(H2,22,24) |
| InChIKey | WPACXOXMVUNTIN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|