C21H29Cl2NO4 — CID 17292155
N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride (PubChem CID 17292155) has the molecular formula C21H29Cl2NO4 and a molecular weight of 430.37 g/mol. Its IUPAC name is N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17292155 |
| Molecular Formula | C21H29Cl2NO4 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[(3-chloro-4,5-diethoxyphenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCc2ccc(OC)c(OC)c2)cc(Cl)c1OCC.Cl |
| InChI | InChI=1S/C21H28ClNO4.ClH/c1-5-26-20-13-16(11-17(22)21(20)27-6-2)14-23-10-9-15-7-8-18(24-3)19(12-15)25-4;/h7-8,11-13,23H,5-6,9-10,14H2,1-4H3;1H |
| InChIKey | HZPQAMFAUNYXKF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|