C18H22ClN2O3+ — CID 7632140
[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-(2-phenylethyl)azanium (PubChem CID 7632140) has the molecular formula C18H22ClN2O3+ and a molecular weight of 349.84 g/mol. Its IUPAC name is [4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-(2-phenylethyl)azanium.
| Compound Name | [4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 7632140 |
| Molecular Formula | C18H22ClN2O3+ |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-(2-phenylethyl)azanium |
| SMILES | COc1cc(C[NH2+]CCc2ccccc2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C18H21ClN2O3/c1-23-16-10-14(9-15(19)18(16)24-12-17(20)22)11-21-8-7-13-5-3-2-4-6-13/h2-6,9-10,21H,7-8,11-12H2,1H3,(H2,20,22)/p+1 |
| InChIKey | XONFTMJDFIPJHO-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|