C11H16Cl2N2O3 — CID 44665968
[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-methylazanium chloride (PubChem CID 44665968) has the molecular formula C11H16Cl2N2O3 and a molecular weight of 295.17 g/mol. Its IUPAC name is [4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-methylazanium chloride.
| Compound Name | [4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-methylazanium chloride |
|---|---|
| PubChem CID | 44665968 |
| Molecular Formula | C11H16Cl2N2O3 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | [4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methyl-methylazanium chloride |
| SMILES | C[NH2+]Cc1cc(Cl)c(OCC(N)=O)c(OC)c1.[Cl-] |
| InChI | InChI=1S/C11H15ClN2O3.ClH/c1-14-5-7-3-8(12)11(9(4-7)16-2)17-6-10(13)15;/h3-4,14H,5-6H2,1-2H3,(H2,13,15);1H |
| InChIKey | WSGWVUCIFLHZDJ-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |