C13H18ClN3O3 — CID 65244504
2-[4-[(3-aminoazetidin-1-yl)methyl]-2-chloro-6-methoxyphenoxy]acetamide (PubChem CID 65244504) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-[4-[(3-aminoazetidin-1-yl)methyl]-2-chloro-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(3-aminoazetidin-1-yl)methyl]-2-chloro-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 65244504 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-[4-[(3-aminoazetidin-1-yl)methyl]-2-chloro-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(CN2CC(N)C2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C13H18ClN3O3/c1-19-11-3-8(4-17-5-9(15)6-17)2-10(14)13(11)20-7-12(16)18/h2-3,9H,4-7,15H2,1H3,(H2,16,18) |
| InChIKey | CLIQIIBPOFXTLG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |