C16H22ClN3O4 — CID 99955086
2-[4-[[(3R)-3-acetamidopyrrolidin-1-yl]methyl]-2-chloro-6-methoxyphenoxy]acetamide (PubChem CID 99955086) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is 2-[4-[[(3R)-3-acetamidopyrrolidin-1-yl]methyl]-2-chloro-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[[(3R)-3-acetamidopyrrolidin-1-yl]methyl]-2-chloro-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 99955086 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-[4-[[(3R)-3-acetamidopyrrolidin-1-yl]methyl]-2-chloro-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(CN2CC[C@@H](NC(C)=O)C2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C16H22ClN3O4/c1-10(21)19-12-3-4-20(8-12)7-11-5-13(17)16(14(6-11)23-2)24-9-15(18)22/h5-6,12H,3-4,7-9H2,1-2H3,(H2,18,22)(H,19,21)/t12-/m1/s1 |
| InChIKey | IKKKJCBNPOKDOG-GFCCVEGCSA-N |
| XLogP | 0.92 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |