C20H27Cl2N2O3- — CID 21233301
2-[4-[(1-adamantylamino)methyl]-2-chloro-6-methoxyphenoxy]acetamide chloride (PubChem CID 21233301) has the molecular formula C20H27Cl2N2O3- and a molecular weight of 414.35 g/mol. Its IUPAC name is 2-[4-[(1-adamantylamino)methyl]-2-chloro-6-methoxyphenoxy]acetamide chloride.
| Compound Name | 2-[4-[(1-adamantylamino)methyl]-2-chloro-6-methoxyphenoxy]acetamide chloride |
|---|---|
| PubChem CID | 21233301 |
| Molecular Formula | C20H27Cl2N2O3- |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-[4-[(1-adamantylamino)methyl]-2-chloro-6-methoxyphenoxy]acetamide chloride |
| SMILES | COc1cc(CNC23CC4CC(CC(C4)C2)C3)cc(Cl)c1OCC(N)=O.[Cl-] |
| InChI | InChI=1S/C20H27ClN2O3.ClH/c1-25-17-6-15(5-16(21)19(17)26-11-18(22)24)10-23-20-7-12-2-13(8-20)4-14(3-12)9-20;/h5-6,12-14,23H,2-4,7-11H2,1H3,(H2,22,24);1H/p-1 |
| InChIKey | VNLDHWDMSHLGEC-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |