C25H30ClNO3 — CID 17216601
3-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylamino]adamantan-1-ol (PubChem CID 17216601) has the molecular formula C25H30ClNO3 and a molecular weight of 427.97 g/mol. Its IUPAC name is 3-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylamino]adamantan-1-ol.
| Compound Name | 3-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylamino]adamantan-1-ol |
|---|---|
| PubChem CID | 17216601 |
| Molecular Formula | C25H30ClNO3 |
| Molecular Weight | 427.97 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methylamino]adamantan-1-ol |
| SMILES | COc1cc(CNC23CC4CC(CC(O)(C4)C2)C3)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H30ClNO3/c1-29-22-9-18(8-21(26)23(22)30-15-17-5-3-2-4-6-17)14-27-24-10-19-7-20(11-24)13-25(28,12-19)16-24/h2-6,8-9,19-20,27-28H,7,10-16H2,1H3 |
| InChIKey | KTWYXNMZJHBCDJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.97 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |