C19H26ClNO3 — CID 27866400
(5S,7R)-3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]adamantan-1-ol (PubChem CID 27866400) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is (5S,7R)-3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]adamantan-1-ol.
| Compound Name | (5S,7R)-3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]adamantan-1-ol |
|---|---|
| PubChem CID | 27866400 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (5S,7R)-3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]adamantan-1-ol |
| SMILES | COc1cc(CNC23C[C@@H]4C[C@@H](CC(O)(C4)C2)C3)cc(Cl)c1OC |
| InChI | InChI=1S/C19H26ClNO3/c1-23-16-5-12(4-15(20)17(16)24-2)10-21-18-6-13-3-14(7-18)9-19(22,8-13)11-18/h4-5,13-14,21-22H,3,6-11H2,1-2H3/t13-,14+,18?,19? |
| InChIKey | AYYXBVRJQWCQQG-BAUKFBFWSA-N |
| XLogP | 3.53 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |