C21H28BrNO2 — CID 4715795
N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]adamantan-1-amine (PubChem CID 4715795) has the molecular formula C21H28BrNO2 and a molecular weight of 406.36 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]adamantan-1-amine.
| Compound Name | N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]adamantan-1-amine |
|---|---|
| PubChem CID | 4715795 |
| Molecular Formula | C21H28BrNO2 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]adamantan-1-amine |
| SMILES | C=CCOc1c(Br)cc(CNC23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C21H28BrNO2/c1-3-4-25-20-18(22)8-17(9-19(20)24-2)13-23-21-10-14-5-15(11-21)7-16(6-14)12-21/h3,8-9,14-16,23H,1,4-7,10-13H2,2H3 |
| InChIKey | RAJCCNDFFQLTFI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|