C22H32BrNO2 — CID 40721628
(1S)-1-(1-adamantyl)-N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]ethanamine (PubChem CID 40721628) has the molecular formula C22H32BrNO2 and a molecular weight of 422.41 g/mol. Its IUPAC name is (1S)-1-(1-adamantyl)-N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]ethanamine.
| Compound Name | (1S)-1-(1-adamantyl)-N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 40721628 |
| Molecular Formula | C22H32BrNO2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (1S)-1-(1-adamantyl)-N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]ethanamine |
| SMILES | CCOc1c(Br)cc(CN[C@@H](C)C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C22H32BrNO2/c1-4-26-21-19(23)8-18(9-20(21)25-3)13-24-14(2)22-10-15-5-16(11-22)7-17(6-15)12-22/h8-9,14-17,24H,4-7,10-13H2,1-3H3/t14-,15?,16?,17?,22?/m0/s1 |
| InChIKey | QBVCVWFHOCQEGA-HIGJEIRPSA-N |
| XLogP | 5.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |