C22H33NO2 — CID 4717148
1-(1-adamantyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]ethanamine (PubChem CID 4717148) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]ethanamine.
| Compound Name | 1-(1-adamantyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 4717148 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 1-(1-adamantyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]ethanamine |
| SMILES | CCOc1ccc(CNC(C)C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C22H33NO2/c1-4-25-20-6-5-16(10-21(20)24-3)14-23-15(2)22-11-17-7-18(12-22)9-19(8-17)13-22/h5-6,10,15,17-19,23H,4,7-9,11-14H2,1-3H3 |
| InChIKey | DDHLGWJQGGGODY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |