C23H31NO2 — CID 19615238
1-(1-adamantyl)-N-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]ethanamine (PubChem CID 19615238) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]ethanamine.
| Compound Name | 1-(1-adamantyl)-N-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 19615238 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 1-(1-adamantyl)-N-[(3-methoxy-4-prop-2-ynoxyphenyl)methyl]ethanamine |
| SMILES | C#CCOc1ccc(CNC(C)C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C23H31NO2/c1-4-7-26-21-6-5-17(11-22(21)25-3)15-24-16(2)23-12-18-8-19(13-23)10-20(9-18)14-23/h1,5-6,11,16,18-20,24H,7-10,12-15H2,2-3H3 |
| InChIKey | KLOHLPHBDYJFKS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|