C28H36ClNO2 — CID 27279630
(1R)-1-(1-adamantyl)-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine (PubChem CID 27279630) has the molecular formula C28H36ClNO2 and a molecular weight of 454.05 g/mol. Its IUPAC name is (1R)-1-(1-adamantyl)-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine.
| Compound Name | (1R)-1-(1-adamantyl)-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 27279630 |
| Molecular Formula | C28H36ClNO2 |
| Molecular Weight | 454.05 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | (1R)-1-(1-adamantyl)-N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine |
| SMILES | CCOc1cc(CN[C@H](C)C23CC4CC(CC(C4)C2)C3)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H36ClNO2/c1-3-31-27-13-21(6-9-26(27)32-18-20-4-7-25(29)8-5-20)17-30-19(2)28-14-22-10-23(15-28)12-24(11-22)16-28/h4-9,13,19,22-24,30H,3,10-12,14-18H2,1-2H3/t19-,22?,23?,24?,28?/m1/s1 |
| InChIKey | ZCPRAMDVLNJAPC-ZSKPCBGVSA-N |
| XLogP | 7.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.05 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |