C21H30ClNO — CID 17156992
1-(1-adamantyl)-N-[(3-chloro-4-ethoxyphenyl)methyl]ethanamine (PubChem CID 17156992) has the molecular formula C21H30ClNO and a molecular weight of 347.93 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-[(3-chloro-4-ethoxyphenyl)methyl]ethanamine.
| Compound Name | 1-(1-adamantyl)-N-[(3-chloro-4-ethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 17156992 |
| Molecular Formula | C21H30ClNO |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-(1-adamantyl)-N-[(3-chloro-4-ethoxyphenyl)methyl]ethanamine |
| SMILES | CCOc1ccc(CNC(C)C23CC4CC(CC(C4)C2)C3)cc1Cl |
| InChI | InChI=1S/C21H30ClNO/c1-3-24-20-5-4-15(9-19(20)22)13-23-14(2)21-10-16-6-17(11-21)8-18(7-16)12-21/h4-5,9,14,16-18,23H,3,6-8,10-13H2,1-2H3 |
| InChIKey | RBYQJVSGWOBPBW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |