C23H34ClNO2 — CID 27279243
(1S)-1-(1-adamantyl)-N-[(3-chloro-4,5-diethoxyphenyl)methyl]ethanamine (PubChem CID 27279243) has the molecular formula C23H34ClNO2 and a molecular weight of 391.98 g/mol. Its IUPAC name is (1S)-1-(1-adamantyl)-N-[(3-chloro-4,5-diethoxyphenyl)methyl]ethanamine.
| Compound Name | (1S)-1-(1-adamantyl)-N-[(3-chloro-4,5-diethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 27279243 |
| Molecular Formula | C23H34ClNO2 |
| Molecular Weight | 391.98 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (1S)-1-(1-adamantyl)-N-[(3-chloro-4,5-diethoxyphenyl)methyl]ethanamine |
| SMILES | CCOc1cc(CN[C@@H](C)C23CC4CC(CC(C4)C2)C3)cc(Cl)c1OCC |
| InChI | InChI=1S/C23H34ClNO2/c1-4-26-21-10-19(9-20(24)22(21)27-5-2)14-25-15(3)23-11-16-6-17(12-23)8-18(7-16)13-23/h9-10,15-18,25H,4-8,11-14H2,1-3H3/t15-,16?,17?,18?,23?/m0/s1 |
| InChIKey | KAHGXUWRPBWACC-SCUMNGBJSA-N |
| XLogP | 5.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.98 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |