C21H29Cl2NO — CID 40721680
(1R)-1-(1-adamantyl)-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]ethanamine (PubChem CID 40721680) has the molecular formula C21H29Cl2NO and a molecular weight of 382.38 g/mol. Its IUPAC name is (1R)-1-(1-adamantyl)-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]ethanamine.
| Compound Name | (1R)-1-(1-adamantyl)-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 40721680 |
| Molecular Formula | C21H29Cl2NO |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (1R)-1-(1-adamantyl)-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]ethanamine |
| SMILES | CCOc1c(Cl)cc(Cl)cc1CN[C@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H29Cl2NO/c1-3-25-20-17(7-18(22)8-19(20)23)12-24-13(2)21-9-14-4-15(10-21)6-16(5-14)11-21/h7-8,13-16,24H,3-6,9-12H2,1-2H3/t13-,14?,15?,16?,21?/m1/s1 |
| InChIKey | AXQYWMUYNGJHAM-BUBBNXEVSA-N |
| XLogP | 6.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |