C19H25Cl2NO — CID 4722272
N-[(3,5-dichloro-2-ethoxyphenyl)methyl]adamantan-1-amine (PubChem CID 4722272) has the molecular formula C19H25Cl2NO and a molecular weight of 354.32 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-ethoxyphenyl)methyl]adamantan-1-amine.
| Compound Name | N-[(3,5-dichloro-2-ethoxyphenyl)methyl]adamantan-1-amine |
|---|---|
| PubChem CID | 4722272 |
| Molecular Formula | C19H25Cl2NO |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[(3,5-dichloro-2-ethoxyphenyl)methyl]adamantan-1-amine |
| SMILES | CCOc1c(Cl)cc(Cl)cc1CNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H25Cl2NO/c1-2-23-18-15(6-16(20)7-17(18)21)11-22-19-8-12-3-13(9-19)5-14(4-12)10-19/h6-7,12-14,22H,2-5,8-11H2,1H3 |
| InChIKey | IKNNOGYUBSKTHT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |