C24H27Cl2NO — CID 4721784
N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]adamantan-1-amine (PubChem CID 4721784) has the molecular formula C24H27Cl2NO and a molecular weight of 416.39 g/mol. Its IUPAC name is N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]adamantan-1-amine.
| Compound Name | N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]adamantan-1-amine |
|---|---|
| PubChem CID | 4721784 |
| Molecular Formula | C24H27Cl2NO |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]adamantan-1-amine |
| SMILES | Clc1ccc(COc2ccc(Cl)cc2CNC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H27Cl2NO/c25-21-3-1-16(2-4-21)15-28-23-6-5-22(26)10-20(23)14-27-24-11-17-7-18(12-24)9-19(8-17)13-24/h1-6,10,17-19,27H,7-9,11-15H2 |
| InChIKey | DZJMMIWVEIRNMR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |