C26H31BrFNO2 — CID 66532606
N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]adamantan-1-amine (PubChem CID 66532606) has the molecular formula C26H31BrFNO2 and a molecular weight of 488.44 g/mol. Its IUPAC name is N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]adamantan-1-amine.
| Compound Name | N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]adamantan-1-amine |
|---|---|
| PubChem CID | 66532606 |
| Molecular Formula | C26H31BrFNO2 |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]adamantan-1-amine |
| SMILES | CCOc1cc(CNC23CC4CC(CC(C4)C2)C3)c(Br)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H31BrFNO2/c1-2-30-24-10-21(15-29-26-12-18-7-19(13-26)9-20(8-18)14-26)23(27)11-25(24)31-16-17-3-5-22(28)6-4-17/h3-6,10-11,18-20,29H,2,7-9,12-16H2,1H3 |
| InChIKey | ZMTXMYRTQCZWET-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |