C17H18Cl3NO — CID 17291748
N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 17291748) has the molecular formula C17H18Cl3NO and a molecular weight of 358.70 g/mol. Its IUPAC name is N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291748 |
| Molecular Formula | C17H18Cl3NO |
| Molecular Weight | 358.70 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-[[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCc1cc(Cl)ccc1OCc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C17H17Cl2NO.ClH/c1-2-9-20-11-14-10-16(19)7-8-17(14)21-12-13-3-5-15(18)6-4-13;/h2-8,10,20H,1,9,11-12H2;1H |
| InChIKey | QYBFLQXPYKVWBD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|