C11H15Cl2NO2 — CID 65369787
1-[3,5-dichloro-2-(ethoxymethoxy)phenyl]-N-methylmethanamine (PubChem CID 65369787) has the molecular formula C11H15Cl2NO2 and a molecular weight of 264.15 g/mol. Its IUPAC name is 1-[3,5-dichloro-2-(ethoxymethoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3,5-dichloro-2-(ethoxymethoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 65369787 |
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-[3,5-dichloro-2-(ethoxymethoxy)phenyl]-N-methylmethanamine |
| SMILES | CCOCOc1c(Cl)cc(Cl)cc1CNC |
| InChI | InChI=1S/C11H15Cl2NO2/c1-3-15-7-16-11-8(6-14-2)4-9(12)5-10(11)13/h4-5,14H,3,6-7H2,1-2H3 |
| InChIKey | ZKLNMNOLTFBFSA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|