C12H18ClNO3 — CID 104664444
1-[5-chloro-2-(ethoxymethoxy)-3-methoxyphenyl]-N-methylmethanamine (PubChem CID 104664444) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 1-[5-chloro-2-(ethoxymethoxy)-3-methoxyphenyl]-N-methylmethanamine.
| Compound Name | 1-[5-chloro-2-(ethoxymethoxy)-3-methoxyphenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 104664444 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-[5-chloro-2-(ethoxymethoxy)-3-methoxyphenyl]-N-methylmethanamine |
| SMILES | CCOCOc1c(CNC)cc(Cl)cc1OC |
| InChI | InChI=1S/C12H18ClNO3/c1-4-16-8-17-12-9(7-14-2)5-10(13)6-11(12)15-3/h5-6,14H,4,7-8H2,1-3H3 |
| InChIKey | LIUFZCUIXNMFQC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|