C13H18ClNO4 — CID 104664543
methyl 3-[4-chloro-2-methoxy-6-(methylaminomethyl)phenoxy]propanoate (PubChem CID 104664543) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is methyl 3-[4-chloro-2-methoxy-6-(methylaminomethyl)phenoxy]propanoate.
| Compound Name | methyl 3-[4-chloro-2-methoxy-6-(methylaminomethyl)phenoxy]propanoate |
|---|---|
| PubChem CID | 104664543 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl 3-[4-chloro-2-methoxy-6-(methylaminomethyl)phenoxy]propanoate |
| SMILES | CNCc1cc(Cl)cc(OC)c1OCCC(=O)OC |
| InChI | InChI=1S/C13H18ClNO4/c1-15-8-9-6-10(14)7-11(17-2)13(9)19-5-4-12(16)18-3/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | MIEFLTRUETYNFT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |