C13H21Cl2NO2 — CID 17156731
N-[(5-chloro-2-ethoxy-3-methoxyphenyl)methyl]propan-2-amine;hydrochloride (PubChem CID 17156731) has the molecular formula C13H21Cl2NO2 and a molecular weight of 294.22 g/mol. Its IUPAC name is N-[(5-chloro-2-ethoxy-3-methoxyphenyl)methyl]propan-2-amine;hydrochloride.
| Compound Name | N-[(5-chloro-2-ethoxy-3-methoxyphenyl)methyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17156731 |
| Molecular Formula | C13H21Cl2NO2 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-[(5-chloro-2-ethoxy-3-methoxyphenyl)methyl]propan-2-amine;hydrochloride |
| SMILES | CCOc1c(CNC(C)C)cc(Cl)cc1OC.Cl |
| InChI | InChI=1S/C13H20ClNO2.ClH/c1-5-17-13-10(8-15-9(2)3)6-11(14)7-12(13)16-4;/h6-7,9,15H,5,8H2,1-4H3;1H |
| InChIKey | XJAQDUAKGLURPE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |