C16H21Cl3N2O2 — CID 90485938
N-[(5-chloro-2-ethoxy-3-methoxyphenyl)methyl]-1-pyridin-3-ylmethanamine;dihydrochloride (PubChem CID 90485938) has the molecular formula C16H21Cl3N2O2 and a molecular weight of 379.72 g/mol. Its IUPAC name is N-[(5-chloro-2-ethoxy-3-methoxyphenyl)methyl]-1-pyridin-3-ylmethanamine;dihydrochloride.
| Compound Name | N-[(5-chloro-2-ethoxy-3-methoxyphenyl)methyl]-1-pyridin-3-ylmethanamine;dihydrochloride |
|---|---|
| PubChem CID | 90485938 |
| Molecular Formula | C16H21Cl3N2O2 |
| Molecular Weight | 379.72 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[(5-chloro-2-ethoxy-3-methoxyphenyl)methyl]-1-pyridin-3-ylmethanamine;dihydrochloride |
| SMILES | CCOc1c(CNCc2cccnc2)cc(Cl)cc1OC.Cl.Cl |
| InChI | InChI=1S/C16H19ClN2O2.2ClH/c1-3-21-16-13(7-14(17)8-15(16)20-2)11-19-10-12-5-4-6-18-9-12;;/h4-9,19H,3,10-11H2,1-2H3;2*1H |
| InChIKey | VFZMJDHUVYTWMA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.72 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |